CymitQuimica logo

CAS 1211590-74-7

:

4-Chloro-6-fluoro-2-pyridinecarboxylic acid

Description:
4-Chloro-6-fluoro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group, at the 4-position with a chlorine atom, and at the 6-position with a fluorine atom. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific properties such as acidity, which can be attributed to the carboxylic acid group, and it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.
Formula:C6H3ClFNO2
InChI:InChI=1S/C6H3ClFNO2/c7-3-1-4(6(10)11)9-5(8)2-3/h1-2H,(H,10,11)
InChI key:InChIKey=BEPFKGFRGBCJFH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Cl)=CC(F)=N1
Synonyms:
  • 4-Chloro-6-fluoro-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 4-chloro-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.