CymitQuimica logo

CAS 1211590-79-2

:

4-(3-Methyl-4H-1,2,4-triazol-4-yl)piperidine

Description:
4-(3-Methyl-4H-1,2,4-triazol-4-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The piperidine part contributes to its cyclic amine properties, while the triazole ring introduces heterocyclic characteristics, often associated with biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms in both the piperidine and triazole rings. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, as triazole derivatives are known for their efficacy in these areas. The presence of the methyl group on the triazole ring can influence the compound's lipophilicity and biological interactions. Overall, 4-(3-Methyl-4H-1,2,4-triazol-4-yl)piperidine is of interest in medicinal chemistry for its potential therapeutic applications and its role in various chemical reactions.
Formula:C8H14N4
InChI:InChI=1S/C8H14N4/c1-7-11-10-6-12(7)8-2-4-9-5-3-8/h6,8-9H,2-5H2,1H3
InChI key:InChIKey=QCCZXUHJRZHKIL-UHFFFAOYSA-N
SMILES:CC=1N(C=NN1)C2CCNCC2
Synonyms:
  • 4-(3-Methyl-4H-1,2,4-triazol-4-yl)piperidine
  • Piperidine, 4-(3-methyl-4H-1,2,4-triazol-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.