CymitQuimica logo

CAS 1211591-40-0

:

4-Chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine

Description:
4-Chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position enhances its reactivity and potential for substitution reactions. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its non-polar characteristics. It has applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The molecular structure allows for various functional group modifications, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions and moderate melting point suggest it can be handled safely in typical chemical environments. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting further investigation into its pharmacological properties.
Formula:C7H7ClN2
InChI:InChI=1S/C7H7ClN2/c8-6-1-2-10-7-4-9-3-5(6)7/h1-2,9H,3-4H2
InChI key:InChIKey=WMBKIRYIBIRARZ-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1)CNC2
Synonyms:
  • 5H-Pyrrolo[3,4-b]pyridine, 4-chloro-6,7-dihydro-
  • 4-Chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.