CymitQuimica logo

CAS 1211591-93-3

:

6-Bromo-2-chloro-3-fluoropyridine

Description:
6-Bromo-2-chloro-3-fluoropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with bromine, chlorine, and fluorine atoms. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. The presence of halogen substituents—specifically bromine at the 6-position, chlorine at the 2-position, and fluorine at the 3-position—affects the compound's physical and chemical properties, including its polarity, solubility, and reactivity in nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is used in various applications, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in synthetic pathways. Its unique combination of halogen atoms can also influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C5H2BrClFN
InChI:InChI=1S/C5H2BrClFN/c6-4-2-1-3(8)5(7)9-4/h1-2H
InChI key:InChIKey=KPQMWTHSSFZPMJ-UHFFFAOYSA-N
SMILES:ClC1=C(F)C=CC(Br)=N1
Synonyms:
  • Pyridine, 6-bromo-2-chloro-3-fluoro-
  • 6-Bromo-2-chloro-3-fluoropyridine
Found 4 products.