CAS 1211592-89-0

Benzene, 1-bromo-3-(1-methylcyclopropyl)-

Description:

Benzene, 1-bromo-3-(1-methylcyclopropyl)- is an organic compound characterized by a bromine atom attached to a benzene ring, which is further substituted with a 1-methylcyclopropyl group. This compound belongs to the class of bromobenzenes and features a cyclic structure due to the presence of the cyclopropyl group, which contributes to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The molecular structure suggests that it may exhibit hydrophobic characteristics due to the aromatic benzene ring, while the cyclopropyl group can introduce strain and influence the compound's stability and reactivity. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the interactions between the aromatic system and the substituents. Overall, Benzene, 1-bromo-3-(1-methylcyclopropyl)- is of interest in organic synthesis and may have applications in the development of pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₁Br

InChI: InChI=1S/C10H11Br/c1-10(5-6-10)8-3-2-4-9(11)7-8/h2-4,7H,5-6H2,1H3

InChI key: InChIKey=VAMAOSCSYXXKTB-UHFFFAOYSA-N

SMILES: CC1(CC1)C2=CC(Br)=CC=C2

Synonyms:

• 1-Bromo-3-(1-methylcyclopropyl)benzene
• Benzene, 1-bromo-3-(1-methylcyclopropyl)-

1-Bromo-3-(1-methylcyclopropyl)benzene

CAS: 1211592-89-0

Versatile small molecule scaffold

Formula: C₁₀H₁₁Br

Purity: Min. 95%

Molecular weight: 211.1 g/mol

Ref: 3D-LYB59289