CymitQuimica logo

CAS 1211592-95-8

:

2-Cyclopropyl-5-oxazolecarbonitrile

Description:
2-Cyclopropyl-5-oxazolecarbonitrile is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and an oxazole ring. The presence of the oxazole moiety suggests potential biological activity, as oxazoles are often found in various natural products and pharmaceuticals. This compound is likely to exhibit properties typical of nitriles, such as being polar and capable of participating in nucleophilic reactions. Its cyclopropyl group may impart strain, influencing its reactivity and stability. Additionally, the compound's molecular structure suggests it could be involved in various chemical reactions, including cycloadditions or substitutions, due to the presence of both the nitrile and the oxazole functionalities. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the compound's interactions with solvents and other reagents. Overall, 2-Cyclopropyl-5-oxazolecarbonitrile represents a compound of interest in synthetic organic chemistry and potentially in medicinal chemistry due to its structural features.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-3-6-4-9-7(10-6)5-1-2-5/h4-5H,1-2H2
InChI key:InChIKey=RHEVIIMRGUJVIJ-UHFFFAOYSA-N
SMILES:C(#N)C=1OC(=NC1)C2CC2
Synonyms:
  • 5-Oxazolecarbonitrile, 2-cyclopropyl-
  • 2-Cyclopropyl-5-oxazolecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.