CAS 1211593-50-8

Cyclobutanamine, 1-(4-pyridinyl)-, hydrobromide (1:2)

Description:

Cyclobutanamine, 1-(4-pyridinyl)-, hydrobromide (1:2) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a pyridine moiety. The presence of the hydrobromide indicates that it is a salt formed with hydrobromic acid, enhancing its solubility in polar solvents. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interaction with other molecules. The pyridine ring contributes to its aromatic character and may impart specific electronic properties, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound's molecular interactions, stability, and reactivity can be influenced by the presence of the hydrobromide, which may also affect its biological activity. Overall, Cyclobutanamine, 1-(4-pyridinyl)-, hydrobromide (1:2) represents a class of compounds that could be of interest in medicinal chemistry and materials science due to its structural features and potential applications.

Formula: C₉H₁₂N₂·2BrH

InChI: InChI=1S/C9H12N2.2BrH/c10-9(4-1-5-9)8-2-6-11-7-3-8;;/h2-3,6-7H,1,4-5,10H2;2*1H

InChI key: InChIKey=BGPJBJDNGSXZCQ-UHFFFAOYSA-N

SMILES: NC1(C=2C=CN=CC2)CCC1.Br

Synonyms:

• Cyclobutanamine, 1-(4-pyridinyl)-, hydrobromide (1:2)