CymitQuimica logo

CAS 1211593-53-1

:

Sulfamoyl chloride, N-(3-methylbutyl)-

Description:
Sulfamoyl chloride, N-(3-methylbutyl)- is an organic compound characterized by the presence of a sulfonamide functional group attached to a chlorinated amine. This compound typically exhibits properties associated with sulfonamides, including potential reactivity due to the presence of the sulfonyl chloride moiety, which can undergo nucleophilic substitution reactions. The N-(3-methylbutyl) group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. As a chlorinated derivative, it may also exhibit higher reactivity compared to non-chlorinated sulfonamides, making it useful in various synthetic applications, including the development of pharmaceuticals and agrochemicals. The compound's structure suggests it may participate in reactions with nucleophiles, such as amines or alcohols, leading to the formation of sulfonamides or other derivatives. Safety precautions are essential when handling this compound, as sulfonamoyl chlorides can be corrosive and may pose health risks upon exposure.
Formula:C5H12ClNO2S
InChI:InChI=1S/C5H12ClNO2S/c1-5(2)3-4-7-10(6,8)9/h5,7H,3-4H2,1-2H3
InChI key:InChIKey=XUXITXYMKNNMKS-UHFFFAOYSA-N
SMILES:N(CCC(C)C)S(Cl)(=O)=O
Synonyms:
  • Sulfamoyl chloride, N-(3-methylbutyl)-
  • N-(3-Methylbutyl)sulfamoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.