CAS 1211594-26-1

1H-Pyrrolo[3,4-b]pyridine, octahydro-6-methyl-, hydrochloride (1:2)

Description:

1H-Pyrrolo[3,4-b]pyridine, octahydro-6-methyl-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a pyrrolidine and a pyridine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The octahydro configuration indicates that the compound has undergone hydrogenation, resulting in a saturated structure that contributes to its stability and potential biological activity. The methyl group at the 6-position of the pyrrolo ring can influence its pharmacological properties, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, including potential applications in neuropharmacology or as a building block in the synthesis of more complex molecules. As with many hydrochloride salts, it is important to handle this substance with care, following appropriate safety protocols due to its potential reactivity and biological effects.

Formula: C₈H₁₆N₂·2ClH

InChI: InChI=1S/C8H16N2.2ClH/c1-10-5-7-3-2-4-9-8(7)6-10;;/h7-9H,2-6H2,1H3;2*1H

InChI key: InChIKey=OLSPYLJJOKFQFD-UHFFFAOYSA-N

SMILES: CN1CC2C(C1)NCCC2.Cl

Synonyms:

• 1H-Pyrrolo[3,4-b]pyridine, octahydro-6-methyl-, hydrochloride (1:2)