CymitQuimica logo

CAS 1211594-36-3

:

[1,1′-Biphenyl]-4-methanamine, 3′-chloro-, hydrochloride (1:1)

Description:
[1,1′-Biphenyl]-4-methanamine, 3′-chloro-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methanamine group at the para position of one phenyl ring and a chlorine substituent at the meta position of the other phenyl ring contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse chemistry associated with substituted biphenyl derivatives.
Formula:C13H12ClN·ClH
InChI:InChI=1S/C13H12ClN.ClH/c14-13-3-1-2-12(8-13)11-6-4-10(9-15)5-7-11;/h1-8H,9,15H2;1H
InChI key:InChIKey=SLUZNNFPTBTUHE-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)C2=CC=C(CN)C=C2.Cl
Synonyms:
  • [1,1′-Biphenyl]-4-methanamine, 3′-chloro-, hydrochloride (1:1)
  • (3′-Chloro-[1,1′-biphenyl]-4-yl)methanamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.