CAS 1211594-43-2
:4-[4-(2-Chlorophenyl)-2-oxazolyl]benzenamine
Description:
4-[4-(2-Chlorophenyl)-2-oxazolyl]benzenamine, identified by its CAS number 1211594-43-2, is an organic compound characterized by its complex structure that includes an oxazole ring and an aniline moiety. This compound features a chlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of the oxazole ring suggests that it may exhibit heterocyclic properties, which can influence its reactivity and interactions with biological targets. Typically, compounds of this nature may be investigated for their pharmacological properties, including potential applications in medicinal chemistry. The amine functional group can participate in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the chlorinated aromatic ring may affect the compound's electronic properties, stability, and reactivity. Overall, the unique combination of functional groups in 4-[4-(2-Chlorophenyl)-2-oxazolyl]benzenamine positions it as a compound of interest in various chemical and pharmaceutical research contexts.
Formula:C15H11ClN2O
InChI:InChI=1S/C15H11ClN2O/c16-13-4-2-1-3-12(13)14-9-19-15(18-14)10-5-7-11(17)8-6-10/h1-9H,17H2
InChI key:InChIKey=OVQNVKYJFFUTID-UHFFFAOYSA-N
SMILES:ClC1=C(C=2N=C(OC2)C3=CC=C(N)C=C3)C=CC=C1
Synonyms:- 4-[4-(2-Chlorophenyl)-2-oxazolyl]benzenamine
- Benzenamine, 4-[4-(2-chlorophenyl)-2-oxazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
