
CAS 1211594-99-8
:4,1-Benzothiazepine, 1,2,3,5-tetrahydro-, 4,4-dioxide
Description:
4,1-Benzothiazepine, 1,2,3,5-tetrahydro-, 4,4-dioxide is a heterocyclic compound characterized by a fused benzene and thiazepine ring system. This compound features a tetrahydro structure, indicating the presence of four hydrogenated carbon atoms, which contributes to its stability and reactivity. The "4,4-dioxide" designation suggests the presence of two oxo groups (double-bonded oxygen) at the 4-position of the thiazepine ring, which can significantly influence its chemical properties, including polarity and potential reactivity with nucleophiles. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly for its potential therapeutic applications. Its unique structure allows for various interactions with biological targets, which can be explored in drug design. Additionally, the presence of sulfur in the thiazepine ring can impart distinctive electronic properties, affecting the compound's behavior in chemical reactions. Overall, 4,1-benzothiazepine derivatives are valuable in research for their diverse applications in pharmaceuticals and organic synthesis.
Formula:C9H11NO2S
InChI:InChI=1S/C9H11NO2S/c11-13(12)6-5-10-9-4-2-1-3-8(9)7-13/h1-4,10H,5-7H2
InChI key:InChIKey=DBTAVLNDPCBSQR-UHFFFAOYSA-N
SMILES:O=S1(=O)CC=2C(NCC1)=CC=CC2
Synonyms:- 4,1-Benzothiazepine, 1,2,3,5-tetrahydro-, 4,4-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.