CAS 1211595-29-7
:8-Chloro-6-(4-pyridinyl)-1,7-naphthyridine
Description:
8-Chloro-6-(4-pyridinyl)-1,7-naphthyridine is a heterocyclic compound characterized by its complex structure, which includes a naphthyridine core substituted with a chlorine atom and a pyridine ring. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of the chlorine atom can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The pyridine moiety may contribute to its ability to form hydrogen bonds and participate in various chemical reactions. Additionally, compounds of this type are often studied for their potential applications in pharmaceuticals, particularly as inhibitors or modulators in biological pathways. Its molecular structure suggests that it may exhibit specific electronic properties, which can be leveraged in drug design. Overall, 8-Chloro-6-(4-pyridinyl)-1,7-naphthyridine represents a class of compounds that are valuable in the exploration of new therapeutic agents.
Formula:C13H8ClN3
InChI:InChI=1S/C13H8ClN3/c14-13-12-10(2-1-5-16-12)8-11(17-13)9-3-6-15-7-4-9/h1-8H
InChI key:InChIKey=YETCPVJIUJSNAL-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(N1)C=3C=CN=CC3)C=CC=N2
Synonyms:- 1,7-Naphthyridine, 8-chloro-6-(4-pyridinyl)-
- 8-Chloro-6-(4-pyridinyl)-1,7-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
