
CAS 1211595-74-2
:1-(3-Pyridinyl)cyclobutanecarboxylic acid
Description:
1-(3-Pyridinyl)cyclobutanecarboxylic acid is an organic compound characterized by its unique structure, which includes a cyclobutane ring and a pyridine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the pyridine ring, a six-membered aromatic heterocycle containing nitrogen, imparts specific electronic characteristics, influencing its reactivity and potential biological activity. The cyclobutane ring adds rigidity to the molecular structure, which can affect the compound's conformation and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the surrounding conditions, such as pH and solvent. Overall, 1-(3-Pyridinyl)cyclobutanecarboxylic acid represents a class of compounds that could have applications in drug development or as intermediates in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c12-9(13)10(4-2-5-10)8-3-1-6-11-7-8/h1,3,6-7H,2,4-5H2,(H,12,13)
InChI key:InChIKey=GEZOXBPFLLULTK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCC1)C=2C=CC=NC2
Synonyms:- 1-(3-Pyridinyl)cyclobutanecarboxylic acid
- Cyclobutanecarboxylic acid, 1-(3-pyridinyl)-
- 1-(Pyridin-3-yl)cyclobutane-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.