CAS 1211595-82-2
:5-Chloro-7-(4-pyridinyl)-1,6-naphthyridine
Description:
5-Chloro-7-(4-pyridinyl)-1,6-naphthyridine is a heterocyclic compound characterized by its fused ring structure, which includes a naphthyridine core and a pyridine substituent. This compound features a chlorine atom at the 5-position and a pyridinyl group at the 7-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the pyridinyl group may enhance its biological activity, making it of interest in medicinal chemistry for potential pharmaceutical applications. Its molecular structure suggests that it may participate in hydrogen bonding and π-π stacking interactions, which are important in biological systems. Overall, 5-Chloro-7-(4-pyridinyl)-1,6-naphthyridine is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C13H8ClN3
InChI:InChI=1S/C13H8ClN3/c14-13-10-2-1-5-16-12(10)8-11(17-13)9-3-6-15-7-4-9/h1-8H
InChI key:InChIKey=ACJRZOUGHDPIOB-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(N1)C=3C=CN=CC3)N=CC=C2
Synonyms:- 5-Chloro-7-(4-pyridinyl)-1,6-naphthyridine
- 1,6-Naphthyridine, 5-chloro-7-(4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
