
CAS 1211596-04-1
:2-(1-Ethynylcyclobutyl)pyridine
Description:
2-(1-Ethynylcyclobutyl)pyridine is an organic compound characterized by its unique structure, which includes a pyridine ring and a cyclobutyl group with an ethynyl substituent. The presence of the pyridine moiety imparts basic properties to the compound, making it a potential ligand in coordination chemistry. The ethynyl group contributes to its reactivity, allowing for various chemical transformations, such as coupling reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its relatively non-polar characteristics. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their biological activities. Additionally, the presence of the ethynyl group may facilitate further functionalization, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H11N
InChI:InChI=1S/C11H11N/c1-2-11(7-5-8-11)10-6-3-4-9-12-10/h1,3-4,6,9H,5,7-8H2
InChI key:InChIKey=DXOAEZWTTPIQMJ-UHFFFAOYSA-N
SMILES:C(#C)C1(CCC1)C2=CC=CC=N2
Synonyms:- Pyridine, 2-(1-ethynylcyclobutyl)-
- 2-(1-Ethynylcyclobutyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
