CAS 1211596-20-1

Thieno[3,2-d]pyrimidine-7-carboxylic acid

Description:

Thieno[3,2-d]pyrimidine-7-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group at the 7-position, enhancing its acidity and potential for forming hydrogen bonds. The presence of sulfur in the thieno ring and nitrogen in the pyrimidine ring imparts distinct electronic properties, making it a subject of interest in medicinal chemistry and drug development. Thieno[3,2-d]pyrimidine derivatives are often explored for their biological activities, including anti-inflammatory and anticancer properties. The compound's solubility and reactivity can be influenced by the functional groups present, making it versatile for various synthetic applications. Additionally, its structural features allow for potential interactions with biological targets, which is crucial for its evaluation in pharmacological studies. Overall, Thieno[3,2-d]pyrimidine-7-carboxylic acid represents a valuable scaffold in the development of novel therapeutic agents.

Formula: C₇H₄N₂O₂S

InChI: InChI=1S/C7H4N2O2S/c10-7(11)4-2-12-5-1-8-3-9-6(4)5/h1-3H,(H,10,11)

InChI key: InChIKey=PUWCNAHJTYTHKV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(SC1)=CN=CN2

Synonyms:

• Thieno[3,2-d]pyrimidine-7-carboxylic acid

Thieno[3,2-d]pyrimidine-7-carboxylic acid

CAS: 1211596-20-1

Thieno[3,2-d]pyrimidine-7-carboxylic acid

Purity: 95%

Molecular weight: 180.18g/mol

Ref: 54-OR1031358

Thieno[3,2-d]pyrimidine-7-carboxylic acid

CAS: 1211596-20-1

Formula: C₇H₄N₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.18

Ref: 10-F302340