
CAS 1211596-21-2
:4-Amino-1H-imidazole-1-ethanol
Description:
4-Amino-1H-imidazole-1-ethanol is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the imidazole ring, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of these functional groups enhances its solubility in polar solvents and may impart biological activity, making it of interest in pharmaceutical research. The compound's molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and stability. Additionally, 4-Amino-1H-imidazole-1-ethanol may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in the synthesis of more complex molecules. Its CAS number, 1211596-21-2, uniquely identifies it in chemical databases, facilitating research and application in various fields, including biochemistry and materials science.
Formula:C5H9N3O
InChI:InChI=1S/C5H9N3O/c6-5-3-8(1-2-9)4-7-5/h3-4,9H,1-2,6H2
InChI key:InChIKey=KSLXTNSDGRBKSN-UHFFFAOYSA-N
SMILES:C(CO)N1C=C(N)N=C1
Synonyms:- 1H-Imidazole-1-ethanol, 4-amino-
- 4-Amino-1H-imidazole-1-ethanol
- 2-(4-Amino-1H-imidazol-1-yl)ethan-1-ol
- 2-(4-Amino-1H-imidazol-1-yl)ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.