
CAS 1211596-27-8
:4-Amino-1H-imidazole-1-propanoic acid
Description:
4-Amino-1H-imidazole-1-propanoic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a propanoic acid moiety, contributing to its properties as an amino acid derivative. It is typically a white to off-white solid and is soluble in water due to the presence of polar functional groups. The compound is of interest in biochemical research, particularly in studies related to metabolic pathways and enzyme activity, as it may serve as a precursor or intermediate in the synthesis of biologically relevant molecules. Its potential applications extend to pharmaceuticals and biochemistry, where it may influence various biological processes. The presence of both amino and carboxylic acid functional groups allows it to participate in various chemical reactions, making it versatile in synthetic chemistry. As with many amino acid derivatives, it may exhibit zwitterionic behavior, depending on the pH of the solution.
Formula:C6H9N3O2
InChI:InChI=1S/C6H9N3O2/c7-5-3-9(4-8-5)2-1-6(10)11/h3-4H,1-2,7H2,(H,10,11)
InChI key:InChIKey=YDHDOGJABMNTKB-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C=C(N)N=C1
Synonyms:- 1H-Imidazole-1-propanoic acid, 4-amino-
- 4-Amino-1H-imidazole-1-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.