CAS 1211596-47-2

4-(3-Chlorophenyl)-3-methyl-1H-pyrazole

Description:

4-(3-Chlorophenyl)-3-methyl-1H-pyrazole, identified by its CAS number 1211596-47-2, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 3-chlorophenyl group, indicating the presence of a chlorine atom on the phenyl ring, which can influence its reactivity and biological activity. The methyl group at the 3-position of the pyrazole ring contributes to its structural diversity and potential interactions. Generally, compounds of this type may exhibit various biological activities, making them of interest in medicinal chemistry and drug development. The presence of the chlorophenyl moiety can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Additionally, the specific arrangement of substituents can lead to unique properties, such as varying solubility and stability. Overall, 4-(3-Chlorophenyl)-3-methyl-1H-pyrazole represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₀H₉ClN₂

InChI: InChI=1S/C10H9ClN2/c1-7-10(6-12-13-7)8-3-2-4-9(11)5-8/h2-6H,1H3,(H,12,13)

InChI key: InChIKey=RCIAVYYXKNBXES-UHFFFAOYSA-N

SMILES: CC=1C(C2=CC(Cl)=CC=C2)=CNN1

Synonyms:

• 1H-Pyrazole, 4-(3-chlorophenyl)-3-methyl-
• 4-(3-Chlorophenyl)-3-methyl-1H-pyrazole