CymitQuimica logo

CAS 1211597-02-2

:

6-Azabicyclo[3.2.1]octan-3-one

Description:
6-Azabicyclo[3.2.1]octan-3-one, also known as a bicyclic compound, features a unique structure characterized by a bicyclic framework that includes a nitrogen atom within the ring system. This compound typically exhibits a ketone functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrogen atom imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The bicyclic nature of the compound can influence its steric and electronic properties, making it a subject of interest in medicinal chemistry and drug design. Additionally, its structural features may lead to interesting interactions with biological targets, potentially offering therapeutic benefits. The compound's solubility, stability, and reactivity can vary based on the surrounding environment and substituents, making it a versatile building block in the synthesis of more complex molecules. Overall, 6-Azabicyclo[3.2.1]octan-3-one represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C7H11NO
InChI:InChI=1S/C7H11NO/c9-7-2-5-1-6(3-7)8-4-5/h5-6,8H,1-4H2
InChI key:InChIKey=YKHKXSSNUGYASF-UHFFFAOYSA-N
SMILES:O=C1CC2CC(NC2)C1
Synonyms:
  • 6-Azabicyclo[3.2.1]octan-3-one
  • 6-azabicyclo[3.2.1]octan-3-one hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.