CAS 12116-05-1
:Oxonium, trimethyl-, hexafluorophosphate(1-) (1:1)
Description:
Oxonium, trimethyl-, hexafluorophosphate(1-) (1:1), commonly referred to as trimethyl oxonium hexafluorophosphate, is an ionic compound characterized by the presence of a trimethyl oxonium cation and a hexafluorophosphate anion. The trimethyl oxonium cation is derived from the protonation of trimethylamine, resulting in a positively charged species with three methyl groups attached to an oxygen atom. The hexafluorophosphate anion, PF6-, is a highly stable and non-coordinating anion known for its strong electronegativity due to the presence of six fluorine atoms bonded to a phosphorus atom. This compound is typically used in organic synthesis and as a reagent in various chemical reactions, particularly in the field of ionic liquids and electrochemistry. Its properties include high thermal stability and solubility in polar solvents, making it useful in various applications. However, due to the presence of fluorine, it should be handled with care, as fluorinated compounds can exhibit unique reactivity and toxicity profiles.
Formula:C3H9O·F6P
InChI:InChI=1S/C3H9O.F6P/c1-4(2)3;1-7(2,3,4,5)6/h1-3H3;/q+1;-1
InChI key:InChIKey=GARJBAQVHHSPGF-UHFFFAOYSA-N
SMILES:[O+](C)(C)C.[P+5]([F-])([F-])([F-])([F-])([F-])[F-]
Synonyms:- Nsc 176019
- Oxonium, trimethyl-, hexafluorophosphate(1-)
- Oxonium, trimethyl-, hexafluorophosphate(1-) (1:1)
- Phosphate(1-), hexafluoro-, trimethyloxonium
- Trimethyloxonium
- Trimethyloxonium hexafluorophosphate
- Trimethyloxonium hexafluorophosphate(1-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.