CAS 121170-45-4
:(R)-(+)-1 1 1-TRIFLUOROOCTAN-2-OL 97
Description:
(R)-(+)-1,1,1-Trifluorooctan-2-ol is a chiral alcohol characterized by the presence of a trifluoromethyl group and a long hydrocarbon chain. Its molecular structure features a hydroxyl (-OH) group attached to the second carbon of an octane backbone, which contributes to its solubility properties and reactivity. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in various chemical and pharmaceutical applications. This compound is typically used in organic synthesis and may serve as a building block in the development of fluorinated compounds. Its chirality indicates that it exists in two enantiomeric forms, with the (R)-(+)- configuration being one of them, which can have distinct properties and activities compared to its counterpart. The compound is generally handled with care due to the presence of fluorine, which can impart unique reactivity and toxicity profiles. As with many fluorinated compounds, it may also exhibit environmental persistence, necessitating careful consideration in its use and disposal.
Formula:C8H15F3O
InChI:InChI=1/C8H15F3O/c1-2-3-4-5-6-7(12)8(9,10)11/h7,12H,2-6H2,1H3/t7-/m1/s1
SMILES:CCCCCC[C@H](C(F)(F)F)O
Synonyms:- (R)-(+)-1,1,1-Trifluoro-2-octanol, 97%
- (2R)-1,1,1-trifluorooctan-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
