CymitQuimica logo

CAS 1211758-69-8

:

2-(1-Methylethoxy)-3-nitropyridine

Description:
2-(1-Methylethoxy)-3-nitropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a nitro group (-NO2) at the 3-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The 1-methylethoxy group, which is an ether functional group, is attached at the 2-position, influencing the compound's solubility and polarity. This compound is likely to exhibit moderate to high stability under standard conditions, but the nitro group may render it susceptible to reduction reactions. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (methylethoxy) groups can affect its electronic properties, making it an interesting candidate for further study in medicinal chemistry or materials science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-6(2)13-8-7(10(11)12)4-3-5-9-8/h3-6H,1-2H3
InChI key:InChIKey=IIEBBISRDCADBW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(OC(C)C)N=CC=C1
Synonyms:
  • 2-Isopropoxy-3-nitropyridine
  • 3-Nitro-2-(propan-2-yloxy)pyridine
  • Pyridine, 2-(1-methylethoxy)-3-nitro-
  • 2-(1-Methylethoxy)-3-nitropyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.