CAS 121177-82-0
:4-(N-Methylaminocarbonyl)phenylboronic acid
Description:
4-(N-Methylaminocarbonyl)phenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also features a N-methylaminocarbonyl substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing moderate stability under standard conditions. The boronic acid moiety allows for reversible interactions with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. Its ability to form complexes with biomolecules can be leveraged in drug development and targeted delivery systems. Additionally, the presence of the N-methylaminocarbonyl group may influence its reactivity and biological activity, potentially enhancing its utility in therapeutic contexts. Overall, this compound is of interest in both academic research and industrial applications due to its unique structural features and functional properties.
Formula:C8H10BNO3
InChI:InChI=1/C8H10BNO3/c1-10-8(11)6-2-4-7(5-3-6)9(12)13/h2-5,12-13H,1H3,(H,10,11)
SMILES:CNC(=O)c1ccc(cc1)B(O)O
Synonyms:- [4-(Methylcarbamoyl)Phenyl]Boronic Acid
- 4-(N-Methylaminocarbonyl)Benzeneboronic Acid
- 4-(Methylcarbamoyl)Phenylboronic Acid
- 4-(Methylcarbamoyl)benzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Methylcarbamoyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H10BNO3Color and Shape:White to Almost white powder to crystalMolecular weight:178.984-(N-Methylaminocarbonyl)Phenylboronic Acid
CAS:Formula:C8H10BNO3Purity:98%Color and Shape:SolidMolecular weight:178.98094-(Methylcarbamoyl)benzeneboronic acid
CAS:4-(Methylcarbamoyl)benzeneboronic acidFormula:C8H10BNO3Purity:98%Color and Shape:SolidMolecular weight:178.98g/mol(4-(Methylcarbamoyl)phenyl)boronic acid
CAS:Please enquire for more information about (4-(Methylcarbamoyl)phenyl)boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H10BNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:178.98 g/mol4-(N-Methylaminocarbonyl)phenylboronic acid
CAS:Formula:C8H10BNO3Purity:95%Color and Shape:SolidMolecular weight:178.98





