CAS 121180-58-3

4-Chloro-6-methyl-2-[(phenylmethyl)thio]pyrimidine

Description:

4-Chloro-6-methyl-2-[(phenylmethyl)thio]pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at position 4 and a methyl group at position 6 contributes to its chemical reactivity and solubility properties. The compound also features a phenylmethylthio group at position 2, which enhances its potential for biological activity and interaction with various biological targets. This compound may exhibit properties typical of pyrimidine derivatives, such as being a potential candidate for pharmaceutical applications, particularly in the development of antiviral or anticancer agents. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of both electron-withdrawing and electron-donating groups. Overall, 4-Chloro-6-methyl-2-[(phenylmethyl)thio]pyrimidine is a compound of interest in medicinal chemistry and organic synthesis.

Formula: C₁₂H₁₁ClN₂S

InChI: InChI=1S/C12H11ClN2S/c1-9-7-11(13)15-12(14-9)16-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3

InChI key: InChIKey=ICSSORBMWQSROY-UHFFFAOYSA-N

SMILES: S(CC1=CC=CC=C1)C=2N=C(C)C=C(Cl)N2

Synonyms:

• 2-(Benzylsulfanyl)-4-chloro-6-methylpyrimidine
• 2-Benzylsulfanyl-4-chloro-6-methylpyrimidine
• 4-Chloro-6-methyl-2-[(phenylmethyl)thio]pyrimidine
• Pyrimidine, 4-chloro-6-methyl-2-[(phenylmethyl)thio]-