CymitQuimica logo

CAS 1212-39-1

:

methyl 3-{3-[(2-fluoroethyl)amino]phenyl}propanoate hydrochloride (1:1)

Description:
Methyl 3-{3-[(2-fluoroethyl)amino]phenyl}propanoate hydrochloride is a chemical compound characterized by its ester functional group, which is derived from propanoic acid and methanol. The presence of a fluorinated ethylamine moiety indicates potential biological activity, as fluorine can enhance the lipophilicity and metabolic stability of the compound. The hydrochloride form suggests that it is a salt, which typically improves solubility in water and may influence its pharmacokinetic properties. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structure suggests potential interactions with biological receptors or enzymes, making it of interest in drug design and development. Additionally, the presence of the aromatic ring may contribute to its stability and reactivity. As with many chemical substances, safety and handling precautions are essential, particularly due to the presence of the fluorine atom and the amine group, which may pose specific health risks.
Formula:C12H17ClFNO2
InChI:InChI=1/C12H16FNO2.ClH/c1-16-12(15)6-5-10-3-2-4-11(9-10)14-8-7-13;/h2-4,9,14H,5-8H2,1H3;1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.