CAS 1212058-03-1

3-[2-(Chloromethyl)phenyl]pyrrolidine

Description:

3-[2-(Chloromethyl)phenyl]pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a chloromethyl group attached to a phenyl ring at the 2-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. The chloromethyl group can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the nitrogen atom in the pyrrolidine ring can engage in hydrogen bonding, influencing the compound's interactions with biological targets. Overall, 3-[2-(Chloromethyl)phenyl]pyrrolidine is of interest for its potential applications in drug development and as a building block in the synthesis of more complex molecules. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values.

Formula: C₁₁H₁₄ClN

InChI: InChI=1S/C11H14ClN/c12-7-9-3-1-2-4-11(9)10-5-6-13-8-10/h1-4,10,13H,5-8H2

InChI key: InChIKey=DQWRYJWQSLZVPX-UHFFFAOYSA-N

SMILES: C(Cl)C1=C(C=CC=C1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-[2-(chloromethyl)phenyl]-
• 3-[2-(Chloromethyl)phenyl]pyrrolidine