CAS 1212059-23-8
:5-(Fluoromethylene)-1,5-dihydro-4-phenyl-2H-pyrrol-2-one
Description:
5-(Fluoromethylene)-1,5-dihydro-4-phenyl-2H-pyrrol-2-one is a synthetic organic compound characterized by its unique pyrrolone structure, which features a fluoromethylene group and a phenyl substituent. This compound typically exhibits a molecular framework that includes a five-membered ring containing both nitrogen and carbon atoms, contributing to its potential reactivity and biological activity. The presence of the fluoromethylene group may enhance its lipophilicity and influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the electronic effects of the fluorine atom and the phenyl group. Additionally, its potential applications may include roles in drug development or as a building block in organic synthesis. As with many pyrrolone derivatives, it may exhibit interesting pharmacological properties, warranting further investigation into its biological effects and mechanisms of action.
Formula:C11H8FNO
InChI:InChI=1S/C11H8FNO/c12-7-10-9(6-11(14)13-10)8-4-2-1-3-5-8/h1-7H,(H,13,14)
InChI key:InChIKey=UMRFVGALJMRYMF-UHFFFAOYSA-N
SMILES:C(F)=C1C(=CC(=O)N1)C2=CC=CC=C2
Synonyms:- 2H-Pyrrol-2-one, 5-(fluoromethylene)-1,5-dihydro-4-phenyl-
- 5-(Fluoromethylene)-1,5-dihydro-4-phenyl-2H-pyrrol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
