CAS 1212060-00-8

Benzenamine, 3-[2-(1,2,3,4-tetrahydro-8-methoxy-2-quinolinyl)ethyl]-, hydrochloride (1:2)

Description:

Benzenamine, 3-[2-(1,2,3,4-tetrahydro-8-methoxy-2-quinolinyl)ethyl]-, hydrochloride (1:2), with CAS number 1212060-00-8, is a chemical compound that features a complex structure combining a benzenamine moiety with a tetrahydroquinoline derivative. This compound is characterized by its amine functional group, which contributes to its basicity and potential reactivity in various chemical environments. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and applications would depend on further studies, including its mechanism of action, toxicity, and efficacy in biological systems. Overall, the structural features of this compound suggest potential utility in various chemical and pharmaceutical applications.

Formula: C₁₈H₂₂N₂O·2ClH

InChI: InChI=1S/C18H22N2O.2ClH/c1-21-17-7-3-5-14-9-11-16(20-18(14)17)10-8-13-4-2-6-15(19)12-13;;/h2-7,12,16,20H,8-11,19H2,1H3;2*1H

InChI key: InChIKey=VXYZXZSLOJMVAB-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(CCC(CCC3=CC(N)=CC=C3)N2)=CC=C1.Cl

Synonyms:

• Benzenamine, 3-[2-(1,2,3,4-tetrahydro-8-methoxy-2-quinolinyl)ethyl]-, hydrochloride (1:2)