CAS 121208-93-3

4-HYDROXY-3-IODOBENZENESUFONIC ACID, SODIUM SALT

Description:

4-Hydroxy-3-iodobenzenesulfonic acid, sodium salt, is an organic compound characterized by its sulfonic acid functional group, which enhances its solubility in water. This compound features a hydroxyl group and an iodine atom attached to a benzene ring, contributing to its unique chemical properties. The presence of the sulfonate group imparts strong acidic characteristics, making it useful in various applications, including as a reagent in organic synthesis and in dye manufacturing. The sodium salt form improves its stability and solubility in aqueous solutions, facilitating its use in biological and chemical processes. Additionally, the iodine substituent can play a role in enhancing the compound's reactivity, making it valuable in substitution reactions. Overall, this compound is notable for its potential applications in pharmaceuticals, analytical chemistry, and as a precursor in the synthesis of other chemical entities. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₆H₄INaO₄S

InChI: InChI=1/C6H5IO4S.Na/c7-5-3-4(12(9,10)11)1-2-6(5)8;/h1-3,8H,(H,9,10,11);/q;+1/p-1/rC6H4INaO4S/c7-5-3-4(1-2-6(5)9)13(10,11)12-8/h1-3,9H

SMILES: c1cc(c(cc1S(=O)(=O)O)I)O.[Na]