
CAS 1212081-96-3
:N-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-L-alanine
Description:
N-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-L-alanine is a synthetic organic compound characterized by its sulfonamide functional group, which is linked to an L-alanine amino acid. The presence of a chloro group and a trifluoromethyl group on the aromatic ring contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is typically used in pharmaceutical research and development, particularly in the context of drug design and synthesis. Its sulfonyl moiety may enhance interactions with biological targets, making it of interest in medicinal chemistry. The compound's structure suggests it may exhibit specific reactivity patterns, such as nucleophilic substitution or electrophilic aromatic substitution, depending on the reaction conditions. Additionally, the trifluoromethyl group can influence the compound's metabolic stability and pharmacokinetics. Overall, N-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-L-alanine represents a class of compounds that are valuable in the exploration of new therapeutic agents.
Formula:C10H9ClF3NO4S
InChI:InChI=1S/C10H9ClF3NO4S/c1-5(9(16)17)15-20(18,19)6-2-3-8(11)7(4-6)10(12,13)14/h2-5,15H,1H3,(H,16,17)/t5-/m0/s1
InChI key:InChIKey=QRVAYYUDAPMGRC-YFKPBYRVSA-N
SMILES:S(N[C@H](C(O)=O)C)(=O)(=O)C1=CC(C(F)(F)F)=C(Cl)C=C1
Synonyms:- L-Alanine, N-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl]-
- N-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-L-alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.