
CAS 1212111-83-5
:(2R)-2-(1-Methoxy-1-methylethyl)pyrrolidine
Description:
(2R)-2-(1-Methoxy-1-methylethyl)pyrrolidine, with the CAS number 1212111-83-5, is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the (2R) configuration indicates that it has specific stereochemistry, which can influence its biological activity and interactions. The methoxy group and the branched alkyl substituent contribute to its overall hydrophobic character, potentially affecting its solubility and reactivity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis typically involves the formation of the pyrrolidine ring followed by the introduction of the methoxy and alkyl groups. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Understanding its characteristics is crucial for applications in drug development and other chemical processes.
Formula:C8H17NO
InChI:InChI=1S/C8H17NO/c1-8(2,10-3)7-5-4-6-9-7/h7,9H,4-6H2,1-3H3/t7-/m1/s1
InChI key:InChIKey=ZPGUMFCNPREQSF-SSDOTTSWSA-N
SMILES:C(OC)(C)(C)[C@H]1CCCN1
Synonyms:- (2R)-2-(1-Methoxy-1-methylethyl)pyrrolidine
- (R)-2-(1-Methoxy-1-methyl-ethyl)-pyrrolidine
- (R)-2-(2-Methoxypropan-2-yl)pyrrolidine
- Pyrrolidine, 2-(1-methoxy-1-methylethyl)-, (2R)-
- (2R)-2-(2-Methoxypropan-2-yl)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.