CAS 121219-12-3
:4-n-Pentylbenzeneboronic acid
Description:
4-n-Pentylbenzeneboronic acid, with the CAS number 121219-12-3, is an organic compound that belongs to the class of boronic acids. It features a boron atom bonded to a phenyl group and a pentyl substituent, which contributes to its hydrophobic characteristics. This compound is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. Its structure includes a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the pentyl chain enhances its lipophilicity, which can influence its reactivity and interaction with biological systems. 4-n-Pentylbenzeneboronic acid is often utilized in the development of sensors, drug delivery systems, and as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as boronic acids can be sensitive to moisture and air.
Formula:C11H17BO2
InChI:InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3
SMILES:CCCCCc1ccc(cc1)B(O)O
Synonyms:- 4-n-Amylbenzeneboronic acid
- 4-n-Pentylphenylboronic acid
- (4-Pentylphenyl)Boronic Acid
- 4-Pentylbenzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C11H17BO2Color and Shape:White to Almost white powder to crystalMolecular weight:192.07(4-Pentylphenyl)boronic acid
CAS:Formula:C11H17BO2Purity:97%Color and Shape:SolidMolecular weight:192.06254-(Pent-1-yl)benzeneboronic acid
CAS:4-(Pent-1-yl)benzeneboronic acidFormula:C11H17BO2Purity:97%Color and Shape: white solidMolecular weight:192.06g/mol4-N-Pentylphenylboronic acid
CAS:Formula:C11H17BO2Purity:98%Color and Shape:White to almost white powderMolecular weight:192.07




