CymitQuimica logo

CAS 121219-18-9

:

B-(2,3-Difluoro-4′-pentyl[1,1′-biphenyl]-4-yl)boronic acid

Description:
B-(2,3-Difluoro-4′-pentyl[1,1′-biphenyl]-4-yl)boronic acid, with the CAS number 121219-18-9, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that is further substituted with a pentyl chain and difluoro groups. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The difluoro substitution enhances its electronic properties, potentially affecting its reactivity and solubility. The pentyl chain contributes to its hydrophobic characteristics, which can influence its interactions in biological systems or in organic solvents. Additionally, the biphenyl structure may impart unique optical or electronic properties, making it of interest in fields like organic electronics or photonics. Overall, this compound's unique structural features position it as a valuable building block in advanced materials and chemical research.
Formula:C17H19BF2O2
InChI:InChI=1S/C17H19BF2O2/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-11-15(18(21)22)17(20)16(14)19/h6-11,21-22H,2-5H2,1H3
InChI key:InChIKey=IYOLXARVDPOJPG-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(B(O)O)=C1F)C2=CC=C(CCCCC)C=C2
Synonyms:
  • 2,3-Difluoro-4′-pentylbiphenyl-4-boronic acid
  • Boronic acid, B-(2,3-difluoro-4′-pentyl[1,1′-biphenyl]-4-yl)-
  • Boronic acid, (2,3-difluoro-4′-pentyl[1,1′-biphenyl]-4-yl)-
  • B-(2,3-Difluoro-4′-pentyl[1,1′-biphenyl]-4-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.