CymitQuimica logo

CAS 121219-21-4

:

1-Octylxy-2,3-difluorobenzene

Description:
1-Octyl-2,3-difluorobenzene, identified by its CAS number 121219-21-4, is an organic compound characterized by a benzene ring substituted with an octyl group and two fluorine atoms at the 2 and 3 positions. This compound is part of the class of difluorobenzenes, which are known for their unique chemical properties due to the presence of fluorine, a highly electronegative element. The octyl group contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The presence of fluorine atoms can enhance the compound's stability and influence its reactivity, making it useful in various applications, including as a solvent or in the synthesis of more complex organic molecules. Additionally, the molecular structure suggests potential uses in materials science and pharmaceuticals, where specific interactions with biological systems or materials are desired. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit unique toxicological profiles.
Formula:C14H20F2O
InChI:InChI=1/C14H20F2O/c1-2-3-4-5-6-7-11-17-13-10-8-9-12(15)14(13)16/h8-10H,2-7,11H2,1H3
Synonyms:
  • 1,2-difluoro-3-(octyloxy)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.