CymitQuimica logo

CAS 121219-26-9

:

Boronic acid, (2,6-difluoro-3-pentylphenyl)-

Description:
Boronic acid, (2,6-difluoro-3-pentylphenyl)-, identified by its CAS number 121219-26-9, is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with two fluorine atoms and a pentyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of fluorine substituents can influence its electronic properties, potentially enhancing its reactivity or solubility in certain solvents. Additionally, the pentyl group contributes to the hydrophobic character of the molecule, which may affect its interactions in biological systems or in synthetic pathways. Overall, this compound's unique structure allows it to participate in diverse chemical reactions, particularly in the formation of complex organic molecules and in the development of boron-containing materials.
Formula:C11H15BF2O2
InChI:InChI=1S/C11H15BF2O2/c1-2-3-4-5-8-6-7-9(13)10(11(8)14)12(15)16/h6-7,15-16H,2-5H2,1H3
InChI key:InChIKey=RISWBBRIUYHGRU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(F)C(CCCCC)=CC=C1F
Synonyms:
  • (2,6-Difluoro-3-pentylphenyl)boronic acid
  • Boronic acid, (2,6-difluoro-3-pentylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.