CymitQuimica logo

CAS 121221-08-7

:

2-CHLORO-N-QUINOLIN-5-YLACETAMIDE

Description:
2-Chloro-N-quinolin-5-ylacetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a quinoline moiety. This compound typically exhibits properties associated with both amides and heterocyclic compounds. The presence of the chloro group can influence its reactivity and solubility, while the quinoline structure may impart biological activity, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature and may have moderate to high melting and boiling points, typical of similar organic compounds. Its solubility can vary depending on the solvent, with polar solvents generally favoring solubility due to the presence of the amide functional group. Additionally, 2-chloro-N-quinolin-5-ylacetamide may exhibit specific interactions with biological targets, which could be explored for potential pharmaceutical applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, this compound represents a class of chemicals that may have significant implications in research and development.
Formula:C11H9ClN2O
InChI:InChI=1/C11H9ClN2O/c12-7-11(15)14-10-5-1-4-9-8(10)3-2-6-13-9/h1-6H,7H2,(H,14,15)
InChI key:IQXGPGINYWVRSU-UHFFFAOYSA-N
SMILES:c1cc2c(cccn2)c(c1)N=C(CCl)O
Synonyms:
  • 2-chloro-N-quinolin-5-ylacetamide
Found 6 products.