
CAS 1212336-37-2
:(3S)-N,N-Diethyl-3,5-dihydroxy-3-(trifluoromethyl)pentanamide
Description:
(3S)-N,N-Diethyl-3,5-dihydroxy-3-(trifluoromethyl)pentanamide is a chemical compound characterized by its specific stereochemistry and functional groups. The presence of two hydroxy groups indicates that it is a diol, which can participate in hydrogen bonding, potentially influencing its solubility and reactivity. The trifluoromethyl group contributes to the compound's lipophilicity and can enhance biological activity, making it of interest in medicinal chemistry. The diethyl amide functionality suggests that it may exhibit basic properties, allowing it to interact with various biological targets. The stereochemistry, denoted by the (3S) configuration, implies that the compound may exhibit chirality, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound's unique combination of functional groups and stereochemical configuration may lead to interesting properties and applications in fields such as pharmaceuticals or agrochemicals. However, specific data regarding its reactivity, stability, and biological activity would require further investigation through experimental studies.
Formula:C10H18F3NO3
InChI:InChI=1S/C10H18F3NO3/c1-3-14(4-2)8(16)7-9(17,5-6-15)10(11,12)13/h15,17H,3-7H2,1-2H3/t9-/m0/s1
InChI key:InChIKey=ZIMSRHJHTLIYPK-VIFPVBQESA-N
SMILES:[C@@](CC(N(CC)CC)=O)(CCO)(C(F)(F)F)O
Synonyms:- (3S)-N,N-Diethyl-3,5-dihydroxy-3-(trifluoromethyl)pentanamide
- Pentanamide, N,N-diethyl-3,5-dihydroxy-3-(trifluoromethyl)-, (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.