CAS 121240-56-0
:Phosphonium, tetrabutyl-, (hydrogen difluoride) (1:1)
Description:
Phosphonium, tetrabutyl-, (hydrogen difluoride) (1:1), commonly referred to as tetrabutylphosphonium hydrogen difluoride, is an ionic compound characterized by its tetrabutylphosphonium cation and hydrogen difluoride anion. This substance typically appears as a colorless to pale yellow liquid and is known for its high solubility in polar solvents. It exhibits properties typical of ionic compounds, such as relatively high melting and boiling points compared to covalent compounds. The presence of the hydrogen difluoride anion imparts unique reactivity, particularly in fluorination reactions, making it useful in various synthetic applications. Additionally, tetrabutylphosphonium salts are often employed as phase transfer catalysts in organic synthesis due to their ability to facilitate the transfer of ions between immiscible phases. Safety considerations are important, as hydrogen difluoride is a highly corrosive and toxic substance, necessitating careful handling and storage. Overall, this compound is significant in both industrial and research settings, particularly in the fields of organic chemistry and materials science.
Formula:C16H36P·F2H
InChI:InChI=1S/C16H36P.F2H/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-2/h5-16H2,1-4H3;/q+1;-1
InChI key:InChIKey=FBCBCTVQUXYHDG-UHFFFAOYSA-N
SMILES:[H+]([F-])[F-].[P+](CCCC)(CCCC)(CCCC)CCCC
Synonyms:- Fluoride (HF<sub>2</sub><sup>1-</sup>), tetrabutylphosphonium
- Phosphonium, tetrabutyl-, (hydrogen difluoride)
- Phosphonium, tetrabutyl-, (hydrogen difluoride) (1:1)
- Tetrabutylphosphonium Hydrogendifluoride
- Tetrabutylphosphonium fluoride (TBPF-MF)
- Tetrabutylphosphonium hydrogen difluoride
- Fluoride (HF21-), tetrabutylphosphonium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
