CymitQuimica logo

CAS 121246-96-6

:

3-CHLORO-PYRAZINE-2-CARBALDEHYDE

Description:
3-Chloro-pyrazine-2-carbaldehyde is an organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The compound features a chloro substituent at the 3-position and an aldehyde functional group at the 2-position of the pyrazine ring. This structure imparts unique chemical properties, including reactivity due to the electrophilic nature of the aldehyde group and the potential for nucleophilic substitution at the chlorinated position. The compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. 3-Chloro-pyrazine-2-carbaldehyde is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C5H3ClN2O
InChI:InChI=1/C5H3ClN2O/c6-5-4(3-9)7-1-2-8-5/h1-3H
InChI key:QRVSQUNWTBLLOC-UHFFFAOYSA-N
SMILES:c1cnc(c(C=O)n1)Cl
Synonyms:
  • 2-Pyrazinecarboxaldehyde, 3-Chloro-
  • 3-Chloropyrazine-2-carbaldehyde
Found 3 products.