CAS 121247-01-6

3-Fluorophenylglyoxal hydrate

Description:

3-Fluorophenylglyoxal hydrate is a chemical compound characterized by the presence of a fluorine atom attached to a phenyl ring, along with a glyoxal functional group. This compound typically exists as a hydrate, indicating that it contains water molecules in its structure. The presence of the fluorine atom can influence the compound's reactivity and solubility, often enhancing its electrophilic properties. Glyoxal derivatives are known for their utility in organic synthesis, particularly in the formation of various heterocycles and as intermediates in the production of pharmaceuticals. The hydrate form suggests that it may exhibit different physical properties compared to its anhydrous counterpart, such as altered melting and boiling points. Additionally, 3-Fluorophenylglyoxal hydrate may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its specific applications and reactivity can vary based on the functional groups present and the overall molecular structure, which can be explored further in research and development contexts.

Formula: C₈H₇FO₃

InChI: InChI=1/C8H5FO2.H2O/c9-7-3-1-2-6(4-7)8(11)5-10;/h1-5H;1H2

SMILES: c1cc(cc(c1)F)C(=O)C=O.O

Synonyms:

• (3-Fluorophenyl)(Oxo)Acetaldehyde Hydrate

3-Fluorophenylglyoxal hydrate

CAS: 121247-01-6

Formula: C₈H₅FO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 152.1225

Ref: IN-DA003JHP

3-fluorophenylglyoxal hydrate

CAS: 121247-01-6

3-fluorophenylglyoxal hydrate

Formula: C₈H₅FO₂·H₂O

Purity: 97%

Color and Shape: light orange solid

Molecular weight: 170.14g/mol

Ref: 54-PC10535

2-(3-Fluorophenyl)-2-oxoacetaldehyde

CAS: 121247-01-6

Purity: 97%

Molecular weight: 152.1239929

Ref: 10-F605244

3-Fluorophenylglyoxal hydrate

CAS: 121247-01-6

Formula: C₈H₇FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.139

Ref: 10-F035945