CAS 121247-16-3
:1-(2,3-Difluoro-6-nitrophenyl)-2-propanone
Description:
1-(2,3-Difluoro-6-nitrophenyl)-2-propanone, identified by its CAS number 121247-16-3, is an organic compound characterized by the presence of a ketone functional group and a substituted aromatic ring. The molecule features a phenyl group that is modified with two fluorine atoms and a nitro group, which significantly influence its chemical reactivity and physical properties. The difluorination introduces electronegative fluorine atoms, enhancing the compound's polarity and potentially affecting its solubility in various solvents. The nitro group is a strong electron-withdrawing group, which can impact the compound's reactivity in electrophilic aromatic substitution reactions. This compound may exhibit interesting biological activities due to its unique structure, making it a subject of interest in medicinal chemistry and materials science. Additionally, its stability and reactivity can be influenced by the presence of the ketone group, which can participate in various chemical reactions, including nucleophilic additions. Overall, 1-(2,3-Difluoro-6-nitrophenyl)-2-propanone is a versatile compound with potential applications in various fields of chemistry.
Formula:C9H7F2NO3
InChI:InChI=1/C9H7F2NO3/c1-5(13)4-6-8(12(14)15)3-2-7(10)9(6)11/h2-3H,4H2,1H3
InChI key:InChIKey=ICTSDDZTPXZWEM-UHFFFAOYSA-N
SMILES:C(C(C)=O)C1=C(N(=O)=O)C=CC(F)=C1F
Synonyms:- 1-(2,3-Difluoro-6-nitrophenyl)-2-propanone
- 1-(2,3-Difluoro-6-nitrophenyl)propan-2-one
- 2-Propanone, 1-(2,3-difluoro-6-nitrophenyl)-
- 3-Acetylmethyl -1.2-Difluoro-4-Nitrobenzene
- 3-Acetylmethyl-1,2-difluoro-4-nitrobenzene
- 1-(2,3-Difluoro-6-nitrophenyl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
