CAS 121250-04-2

(R)-3,3,3-TRIFLUORO-2-HYDROXYPROPIONIC ACID

Description:

(R)-3,3,3-Trifluoro-2-hydroxypropionic acid is a fluorinated organic compound characterized by the presence of three fluorine atoms and a hydroxyl group attached to a propionic acid backbone. This compound is a chiral molecule, with the (R) configuration indicating the specific spatial arrangement of its atoms. The trifluoromethyl group significantly influences its chemical properties, enhancing its acidity and potentially affecting its reactivity and solubility in various solvents. The hydroxyl group contributes to its ability to form hydrogen bonds, which can impact its interactions with biological systems and other chemical species. This compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in drug development and as a building block in the synthesis of more complex molecules. Its unique characteristics, including high electronegativity from the fluorine atoms, can lead to altered biological activity compared to non-fluorinated analogs. Safety and handling precautions are essential due to the presence of fluorine, which can pose health risks.

Formula: C₃H₃F₃O₃

InChI: InChI=1/C3H3F3O3/c4-3(5,6)1(7)2(8)9/h1,7H,(H,8,9)/t1-/m1/s1

SMILES: [C@@H](C(=O)O)(C(F)(F)F)O

Synonyms:

• (R)-3,3,3-Trifluorolactic Acid
• R-Tf-La
• (R)-2-Hydroxy-3,3,3-trifluoropropionic acid
• (2R)-3,3,3-trifluoro-2-hydroxypropanoic acid

3,3,3-Trifluoro-D-lactic acid

CAS: 121250-04-2

3,3,3-Trifluoro-D-lactic acid

Formula: C₃H₃F₃O₃

Purity: 97%

Color and Shape: low-melting solid

Molecular weight: 144.05g/mol

Ref: 54-PC0618

(R)-3,3,3-Trifluoro-2-hydroxypropanoic acid

CAS: 121250-04-2

Purity: 98%

Molecular weight: 144.048996

Ref: 10-F618865

(R)-Trifluorolactic Acid

Controlled Product

CAS: 121250-04-2

Formula: C₃H₃F₃O₃

Color and Shape: Neat

Molecular weight: 144.049

Ref: TR-T790490