CAS 121280-49-7
:pacidamycin 3
Description:
Pacidamycin 3, identified by its CAS number 121280-49-7, is a member of the pacidamycin family, which are antibiotics derived from microbial sources. This compound exhibits a complex structure characterized by a bicyclic core and various functional groups that contribute to its biological activity. Pacidamycin 3 is known for its potent antibacterial properties, particularly against Gram-positive bacteria, making it a subject of interest in the development of new antimicrobial agents. Its mechanism of action typically involves inhibition of protein synthesis, which is crucial for bacterial growth and reproduction. Additionally, pacidamycin 3 may exhibit unique pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in biological systems. Research into this compound continues to explore its potential therapeutic applications, resistance mechanisms, and the possibility of modifying its structure to enhance efficacy or reduce toxicity. Overall, pacidamycin 3 represents a significant area of study in the field of medicinal chemistry and antibiotic development.
Formula:C39H49N9O13
InChI:InChI=1/C39H49N9O13/c1-19(40)29(51)17-28(46(3)34(55)26(43-33(54)20(2)41)14-21-6-4-8-23(49)12-21)32(42)35(56)48(38(59)44-27(37(57)58)15-22-7-5-9-24(50)13-22)18-25-16-30(52)36(61-25)47-11-10-31(53)45-39(47)60/h4-13,18-20,26-28,30,32,36,49-50,52H,14-17,40-42H2,1-3H3,(H,43,54)(H,44,59)(H,57,58)(H,45,53,60)/b25-18+/t19-,20-,26-,27?,28?,30?,32?,36?/m0/s1
Synonyms:- pacidamycin 3
- Butanamide, N-[[[1-carboxy-2-(3-hydroxyphenyl)ethyl]amino]carbonyl]-L-alanyl-N3-(L-alanyl-3-hydroxyphenylalanyl)-2-amino-N-[(Z)-[(4R,5R)-5-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)dihydro-4-hydroxy-2(3H)-furanylidene]methyl]-3-(methylamino)-, (2S,3S)-
- Butanamide, N-(((1-carboxy-2-(3-hydroxyphenyl)ethyl)amino)carbonyl)alanyl-N3-(N-alanyl-3-hydroxyphenylalanyl)-N-((5-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)dihydro-4-hydroxy-2(3H)-furanylidene)methyl)-N3-methyl-2,3-diamino-
- L-alanyl-N-{(4S)-4-amino-1-[1-amino-2-({[1-carboxy-2-(3-hydroxyphenyl)ethyl]carbamoyl}{(E)-[5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-hydroxydihydrofuran-2(3H)-ylidene]methyl}amino)-2-oxoethyl]-3-oxopentyl}-3-hydroxy-N-methyl-L-phenylalaninamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pacidamycin 3
CAS:Pacidamycin 3 exhibits inhibitory effects against Pseudomonas aeruginosa. It also affects a limited number of other bacterial strains, including Staphylococcus aureus and Escherichia coli.Formula:C39H49N9O13Color and Shape:SolidMolecular weight:851.859
