
CAS 1212846-67-7
:(αS)-α-Methyl-2-(1-methylethyl)benzenemethanamine
Description:
(αS)-α-Methyl-2-(1-methylethyl)benzenemethanamine, also known as a specific chiral amine, is characterized by its structural features that include a benzene ring substituted with an isopropyl group and an amino group. This compound is a derivative of phenethylamine, which is known for its potential biological activity. The presence of the chiral center at the α position contributes to its stereochemistry, influencing its interaction with biological systems, particularly in terms of receptor binding and pharmacological effects. The amine functional group suggests that it may participate in hydrogen bonding, affecting its solubility and reactivity. Additionally, the compound's hydrophobic isopropyl group may enhance its lipophilicity, impacting its distribution in biological systems. Overall, the unique combination of its functional groups and stereochemistry makes (αS)-α-Methyl-2-(1-methylethyl)benzenemethanamine a compound of interest in medicinal chemistry and pharmacology, potentially serving as a lead structure for drug development.
Formula:C11H17N
InChI:InChI=1S/C11H17N/c1-8(2)10-6-4-5-7-11(10)9(3)12/h4-9H,12H2,1-3H3/t9-/m0/s1
InChI key:InChIKey=UMZGHCKRXXENGB-VIFPVBQESA-N
SMILES:C(C)(C)C1=C([C@H](C)N)C=CC=C1
Synonyms:- Benzenemethanamine, α-methyl-2-(1-methylethyl)-, (αS)-
- (αS)-α-Methyl-2-(1-methylethyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
