CAS 1212856-37-5

(1R)-1-[3-Fluoro-4-(trifluoromethoxy)phenyl]-1,2-ethanediamine

Description:

(1R)-1-[3-Fluoro-4-(trifluoromethoxy)phenyl]-1,2-ethanediamine is a chemical compound characterized by its specific stereochemistry and functional groups. It features a chiral center, indicated by the (1R) designation, which contributes to its potential biological activity and interaction with biological targets. The presence of a fluorine atom and a trifluoromethoxy group on the phenyl ring enhances its lipophilicity and may influence its pharmacokinetic properties. The ethylenediamine moiety suggests that it can participate in hydrogen bonding, which is crucial for its interaction with biological macromolecules. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. Additionally, the trifluoromethoxy group can impart stability and modulate the electronic characteristics of the molecule, potentially affecting its reactivity and binding affinity. Overall, this compound's distinct characteristics make it a subject of interest in various chemical and biological research fields.

Formula: C₉H₁₀F₄N₂O

InChI: InChI=1S/C9H10F4N2O/c10-6-3-5(7(15)4-14)1-2-8(6)16-9(11,12)13/h1-3,7H,4,14-15H2/t7-/m0/s1

InChI key: InChIKey=LNEOOEDYRYWJCL-ZETCQYMHSA-N

SMILES: O(C(F)(F)F)C1=C(F)C=C([C@H](CN)N)C=C1

Synonyms:

• 1,2-Ethanediamine, 1-[3-fluoro-4-(trifluoromethoxy)phenyl]-, (1R)-
• (1R)-1-[3-Fluoro-4-(trifluoromethoxy)phenyl]-1,2-ethanediamine