CAS 121289-20-1
:Silane, [[(1R,2S,4R,6R)-1-methyl-7-oxabicyclo[4.1.0]heptane-2,4-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-
Description:
Silane, with the specific name "[(1R,2S,4R,6R)-1-methyl-7-oxabicyclo[4.1.0]heptane-2,4-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-" and CAS number 121289-20-1, is a chemical compound characterized by its silane functional group, which typically consists of silicon atoms bonded to hydrogen and/or organic groups. This particular silane derivative features a bicyclic structure that incorporates oxygen atoms, indicating it may possess unique properties such as enhanced stability or reactivity compared to simpler silanes. The presence of bulky tert-butyl and dimethyl groups suggests that the compound may exhibit steric hindrance, potentially influencing its reactivity and interactions with other substances. Silanes are often utilized in various applications, including as coupling agents in polymer chemistry, surface modifiers, and precursors for silicon-based materials. The specific stereochemistry indicated by the (1R,2S,4R,6R) configuration may also play a crucial role in determining the compound's physical and chemical properties, including its solubility, boiling point, and reactivity.
Formula:C19H40O3Si2
InChI:InChI=1S/C19H40O3Si2/c1-17(2,3)23(8,9)21-14-12-15-19(7,20-15)16(13-14)22-24(10,11)18(4,5)6/h14-16H,12-13H2,1-11H3/t14-,15-,16+,19-/m1/s1
InChI key:InChIKey=NQALZHZPLDGLJR-OAFZBRQQSA-N
SMILES:C[C@]12[C@](O1)(C[C@@H](O[Si](C(C)(C)C)(C)C)C[C@@H]2O[Si](C(C)(C)C)(C)C)[H]
Synonyms:- Silane, [[(1R,2S,4R,6R)-1-methyl-7-oxabicyclo[4.1.0]heptane-2,4-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-
- 7-Oxabicyclo[4.1.0]heptane, silane deriv.
- Silane, [(1-methyl-7-oxabicyclo[4.1.0]heptane-2,4-diyl)bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-, [1R-(1α,2β,4α,6α)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2S,4R,6R)-2,4-Bis(tert-butyldimethylsilyloxy)-1-methyl-cyclohexane 1,2-Epoxide
CAS:Controlled Product<p>Applications Intermediate in the preparation of Dihydroxyvitamin D3 and associated metabolites.<br></p>Formula:C19H40O3Si2Color and Shape:NeatMolecular weight:372.69
