CymitQuimica logo

CAS 1212952-19-6

:

(1R)-5-Chloro-6-fluoro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:
(1R)-5-Chloro-6-fluoro-1,2,3,4-tetrahydro-1-naphthalenamine is a chemical compound characterized by its unique structural features, including a naphthalene ring system that is partially saturated, which contributes to its tetrahydro configuration. The presence of chlorine and fluorine substituents introduces significant polarity and can influence the compound's reactivity and interaction with biological systems. This compound is likely to exhibit basic properties due to the amine functional group, which can participate in hydrogen bonding and may affect its solubility in various solvents. The stereochemistry indicated by the (1R) designation suggests a specific three-dimensional arrangement that can impact its pharmacological activity and binding affinity in biological contexts. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of halogen substituents and amine functionality may also provide avenues for further chemical modifications and applications in various fields, including agrochemicals and materials science.
Formula:C10H11ClFN
InChI:InChI=1S/C10H11ClFN/c11-10-7-2-1-3-9(13)6(7)4-5-8(10)12/h4-5,9H,1-3,13H2/t9-/m1/s1
InChI key:InChIKey=OPCAPLPULMBNLM-SECBINFHSA-N
SMILES:ClC1=C2C([C@H](N)CCC2)=CC=C1F
Synonyms:
  • 1-Naphthalenamine, 5-chloro-6-fluoro-1,2,3,4-tetrahydro-, (1R)-
  • (1R)-5-Chloro-6-fluoro-1,2,3,4-tetrahydro-1-naphthalenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.