CymitQuimica logo

CAS 1212960-34-3

:

(1S)-1-(4-Methoxy-2-methylphenyl)-1,2-ethanediamine

Description:
(1S)-1-(4-Methoxy-2-methylphenyl)-1,2-ethanediamine is an organic compound characterized by its amine functional groups and aromatic structure. It features a chiral center, which contributes to its stereochemistry, specifically the (1S) configuration. The presence of a methoxy group and a methyl group on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit basic properties due to the amine groups, allowing it to participate in hydrogen bonding and interact with various biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such amine-containing compounds are often explored for their therapeutic effects. Additionally, the compound's solubility and reactivity may vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, (1S)-1-(4-Methoxy-2-methylphenyl)-1,2-ethanediamine represents a class of compounds with diverse chemical properties and potential utility in various fields of research.
Formula:C10H16N2O
InChI:InChI=1S/C10H16N2O/c1-7-5-8(13-2)3-4-9(7)10(12)6-11/h3-5,10H,6,11-12H2,1-2H3/t10-/m1/s1
InChI key:InChIKey=SFUCYWNGYOCPIP-SNVBAGLBSA-N
SMILES:[C@H](CN)(N)C1=C(C)C=C(OC)C=C1
Synonyms:
  • 1,2-Ethanediamine, 1-(4-methoxy-2-methylphenyl)-, (1S)-
  • (1S)-1-(4-Methoxy-2-methylphenyl)-1,2-ethanediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.